C6H9ClN4O2S — CID 106240109
2-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethoxy]acetamide (PubChem CID 106240109) has the molecular formula C6H9ClN4O2S and a molecular weight of 236.68 g/mol. Its IUPAC name is 2-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106240109 |
| Molecular Formula | C6H9ClN4O2S |
| Molecular Weight | 236.68 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 2-[2-[(4-chloro-1,2,5-thiadiazol-3-yl)amino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1nsnc1Cl |
| InChI | InChI=1S/C6H9ClN4O2S/c7-5-6(11-14-10-5)9-1-2-13-3-4(8)12/h1-3H2,(H2,8,12)(H,9,11) |
| InChIKey | UJYOOGQFQODQKJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.68 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|