C8H14N4O2S2 — CID 106242108
2-[2-[(3-amino-4-methylsulfanyl-1,2-thiazol-5-yl)amino]ethoxy]acetamide (PubChem CID 106242108) has the molecular formula C8H14N4O2S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-[2-[(3-amino-4-methylsulfanyl-1,2-thiazol-5-yl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(3-amino-4-methylsulfanyl-1,2-thiazol-5-yl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106242108 |
| Molecular Formula | C8H14N4O2S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-[2-[(3-amino-4-methylsulfanyl-1,2-thiazol-5-yl)amino]ethoxy]acetamide |
| SMILES | CSc1c(N)nsc1NCCOCC(N)=O |
| InChI | InChI=1S/C8H14N4O2S2/c1-15-6-7(10)12-16-8(6)11-2-3-14-4-5(9)13/h11H,2-4H2,1H3,(H2,9,13)(H2,10,12) |
| InChIKey | RBONZJRUXYXRLI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|