C11H17N5S2 — CID 103360334
5-N-(4-imidazol-1-ylbutyl)-4-methylsulfanyl-1,2-thiazole-3,5-diamine (PubChem CID 103360334) has the molecular formula C11H17N5S2 and a molecular weight of 283.43 g/mol. Its IUPAC name is 5-N-(4-imidazol-1-ylbutyl)-4-methylsulfanyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(4-imidazol-1-ylbutyl)-4-methylsulfanyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103360334 |
| Molecular Formula | C11H17N5S2 |
| Molecular Weight | 283.43 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 5-N-(4-imidazol-1-ylbutyl)-4-methylsulfanyl-1,2-thiazole-3,5-diamine |
| SMILES | CSc1c(N)nsc1NCCCCn1ccnc1 |
| InChI | InChI=1S/C11H17N5S2/c1-17-9-10(12)15-18-11(9)14-4-2-3-6-16-7-5-13-8-16/h5,7-8,14H,2-4,6H2,1H3,(H2,12,15) |
| InChIKey | WEQWICKFPWYNMN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|