C12H19N5O2S2 — CID 103360335
4-ethylsulfonyl-5-N-(4-imidazol-1-ylbutyl)-1,2-thiazole-3,5-diamine (PubChem CID 103360335) has the molecular formula C12H19N5O2S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 4-ethylsulfonyl-5-N-(4-imidazol-1-ylbutyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-ethylsulfonyl-5-N-(4-imidazol-1-ylbutyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103360335 |
| Molecular Formula | C12H19N5O2S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-ethylsulfonyl-5-N-(4-imidazol-1-ylbutyl)-1,2-thiazole-3,5-diamine |
| SMILES | CCS(=O)(=O)c1c(N)nsc1NCCCCn1ccnc1 |
| InChI | InChI=1S/C12H19N5O2S2/c1-2-21(18,19)10-11(13)16-20-12(10)15-5-3-4-7-17-8-6-14-9-17/h6,8-9,15H,2-5,7H2,1H3,(H2,13,16) |
| InChIKey | CUBFGLNTMYOXGT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|