C13H15N5OS — CID 103426816
5-acetyl-4-amino-2-(3-imidazol-1-ylpropylamino)thiophene-3-carbonitrile (PubChem CID 103426816) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is 5-acetyl-4-amino-2-(3-imidazol-1-ylpropylamino)thiophene-3-carbonitrile.
| Compound Name | 5-acetyl-4-amino-2-(3-imidazol-1-ylpropylamino)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 103426816 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-acetyl-4-amino-2-(3-imidazol-1-ylpropylamino)thiophene-3-carbonitrile |
| SMILES | CC(=O)c1sc(NCCCn2ccnc2)c(C#N)c1N |
| InChI | InChI=1S/C13H15N5OS/c1-9(19)12-11(15)10(7-14)13(20-12)17-3-2-5-18-6-4-16-8-18/h4,6,8,17H,2-3,5,15H2,1H3 |
| InChIKey | GQZIWULDGYGUBV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|