C11H15N5OS — CID 103426808
3-amino-5-(3-imidazol-1-ylpropylamino)thiophene-2-carboxamide (PubChem CID 103426808) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is 3-amino-5-(3-imidazol-1-ylpropylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-5-(3-imidazol-1-ylpropylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103426808 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-amino-5-(3-imidazol-1-ylpropylamino)thiophene-2-carboxamide |
| SMILES | NC(=O)c1sc(NCCCn2ccnc2)cc1N |
| InChI | InChI=1S/C11H15N5OS/c12-8-6-9(18-10(8)11(13)17)15-2-1-4-16-5-3-14-7-16/h3,5-7,15H,1-2,4,12H2,(H2,13,17) |
| InChIKey | SXKYJCPJYDLSRG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|