C14H18N4O2 — CID 107075037
2-amino-5-hydroxy-N-(4-imidazol-1-ylbutyl)benzamide (PubChem CID 107075037) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-amino-5-hydroxy-N-(4-imidazol-1-ylbutyl)benzamide.
| Compound Name | 2-amino-5-hydroxy-N-(4-imidazol-1-ylbutyl)benzamide |
|---|---|
| PubChem CID | 107075037 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-amino-5-hydroxy-N-(4-imidazol-1-ylbutyl)benzamide |
| SMILES | Nc1ccc(O)cc1C(=O)NCCCCn1ccnc1 |
| InChI | InChI=1S/C14H18N4O2/c15-13-4-3-11(19)9-12(13)14(20)17-5-1-2-7-18-8-6-16-10-18/h3-4,6,8-10,19H,1-2,5,7,15H2,(H,17,20) |
| InChIKey | JAQIVTCFUCWILR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|