C19H17N7OS2 — CID 143064290
3-amino-5-cyano-6-(3-imidazol-1-ylpropylamino)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 143064290) has the molecular formula C19H17N7OS2 and a molecular weight of 423.53 g/mol. Its IUPAC name is 3-amino-5-cyano-6-(3-imidazol-1-ylpropylamino)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-5-cyano-6-(3-imidazol-1-ylpropylamino)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143064290 |
| Molecular Formula | C19H17N7OS2 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 3-amino-5-cyano-6-(3-imidazol-1-ylpropylamino)-4-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | N#Cc1c(NCCCn2ccnc2)nc2sc(C(N)=O)c(N)c2c1-c1cccs1 |
| InChI | InChI=1S/C19H17N7OS2/c20-9-11-13(12-3-1-8-28-12)14-15(21)16(17(22)27)29-19(14)25-18(11)24-4-2-6-26-7-5-23-10-26/h1,3,5,7-8,10H,2,4,6,21H2,(H2,22,27)(H,24,25) |
| InChIKey | IXBAPTSJEVMQLF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|