C22H22N6O4S2 — CID 71133781
3-amino-6-[(1-amino-3-ethylsulfonylpropyl)amino]-4-(1-benzofuran-2-yl)-5-cyanothieno[2,3-b]pyridine-2-carboxamide (PubChem CID 71133781) has the molecular formula C22H22N6O4S2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 3-amino-6-[(1-amino-3-ethylsulfonylpropyl)amino]-4-(1-benzofuran-2-yl)-5-cyanothieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-6-[(1-amino-3-ethylsulfonylpropyl)amino]-4-(1-benzofuran-2-yl)-5-cyanothieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71133781 |
| Molecular Formula | C22H22N6O4S2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 3-amino-6-[(1-amino-3-ethylsulfonylpropyl)amino]-4-(1-benzofuran-2-yl)-5-cyanothieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCS(=O)(=O)CCC(N)Nc1nc2sc(C(N)=O)c(N)c2c(-c2cc3ccccc3o2)c1C#N |
| InChI | InChI=1S/C22H22N6O4S2/c1-2-34(30,31)8-7-15(24)27-21-12(10-23)16(14-9-11-5-3-4-6-13(11)32-14)17-18(25)19(20(26)29)33-22(17)28-21/h3-6,9,15H,2,7-8,24-25H2,1H3,(H2,26,29)(H,27,28) |
| InChIKey | VTEDUPVFJWOWFP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 191.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|