C26H30N6O2S — CID 163451467
3-amino-4-(1-benzofuran-2-yl)-5-(methyliminomethyl)-6-(3-piperidin-1-ylpropylamino)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 163451467) has the molecular formula C26H30N6O2S and a molecular weight of 490.63 g/mol. Its IUPAC name is 3-amino-4-(1-benzofuran-2-yl)-5-(methyliminomethyl)-6-(3-piperidin-1-ylpropylamino)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-4-(1-benzofuran-2-yl)-5-(methyliminomethyl)-6-(3-piperidin-1-ylpropylamino)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 163451467 |
| Molecular Formula | C26H30N6O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 3-amino-4-(1-benzofuran-2-yl)-5-(methyliminomethyl)-6-(3-piperidin-1-ylpropylamino)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | C/N=C/c1c(NCCCN2CCCCC2)nc2sc(C(N)=O)c(N)c2c1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C26H30N6O2S/c1-29-15-17-20(19-14-16-8-3-4-9-18(16)34-19)21-22(27)23(24(28)33)35-26(21)31-25(17)30-10-7-13-32-11-5-2-6-12-32/h3-4,8-9,14-15H,2,5-7,10-13,27H2,1H3,(H2,28,33)(H,30,31)/b29-15+ |
| InChIKey | BGYQUCXCUGJTEI-WKULSOCRSA-N |
| XLogP | 4.73 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|