C21H19N5O4S — CID 68729344
[3-amino-4-(1-benzofuran-2-yl)-5-cyano-6-(3-methoxypropylamino)thieno[2,3-b]pyridin-2-yl] carbamate (PubChem CID 68729344) has the molecular formula C21H19N5O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is [3-amino-4-(1-benzofuran-2-yl)-5-cyano-6-(3-methoxypropylamino)thieno[2,3-b]pyridin-2-yl] carbamate.
| Compound Name | [3-amino-4-(1-benzofuran-2-yl)-5-cyano-6-(3-methoxypropylamino)thieno[2,3-b]pyridin-2-yl] carbamate |
|---|---|
| PubChem CID | 68729344 |
| Molecular Formula | C21H19N5O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | [3-amino-4-(1-benzofuran-2-yl)-5-cyano-6-(3-methoxypropylamino)thieno[2,3-b]pyridin-2-yl] carbamate |
| SMILES | COCCCNc1nc2sc(OC(N)=O)c(N)c2c(-c2cc3ccccc3o2)c1C#N |
| InChI | InChI=1S/C21H19N5O4S/c1-28-8-4-7-25-18-12(10-22)15(14-9-11-5-2-3-6-13(11)29-14)16-17(23)20(30-21(24)27)31-19(16)26-18/h2-3,5-6,9H,4,7-8,23H2,1H3,(H2,24,27)(H,25,26) |
| InChIKey | CZTGUBOATMOMDC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|