C18H16N6OS2 — CID 143064286
3-amino-6-[3-(1H-diazet-2-yl)propylamino]-2-formyl-4-thiophen-2-ylthieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 143064286) has the molecular formula C18H16N6OS2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 3-amino-6-[3-(1H-diazet-2-yl)propylamino]-2-formyl-4-thiophen-2-ylthieno[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 3-amino-6-[3-(1H-diazet-2-yl)propylamino]-2-formyl-4-thiophen-2-ylthieno[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 143064286 |
| Molecular Formula | C18H16N6OS2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-amino-6-[3-(1H-diazet-2-yl)propylamino]-2-formyl-4-thiophen-2-ylthieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1c(NCCCn2cc[nH]2)nc2sc(C=O)c(N)c2c1-c1cccs1 |
| InChI | InChI=1S/C18H16N6OS2/c19-9-11-14(12-3-1-8-26-12)15-16(20)13(10-25)27-18(15)23-17(11)21-4-2-6-24-7-5-22-24/h1,3,5,7-8,10,22H,2,4,6,20H2,(H,21,23) |
| InChIKey | PQHCISMBOMMLPO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|