C13H17N5OS — CID 143064281
3,6-diamino-2-formyl-4-propylthieno[2,3-b]pyridine-5-carbonitrile;methanamine (PubChem CID 143064281) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is 3,6-diamino-2-formyl-4-propylthieno[2,3-b]pyridine-5-carbonitrile;methanamine.
| Compound Name | 3,6-diamino-2-formyl-4-propylthieno[2,3-b]pyridine-5-carbonitrile;methanamine |
|---|---|
| PubChem CID | 143064281 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 3,6-diamino-2-formyl-4-propylthieno[2,3-b]pyridine-5-carbonitrile;methanamine |
| SMILES | CCCc1c(C#N)c(N)nc2sc(C=O)c(N)c12.CN |
| InChI | InChI=1S/C12H12N4OS.CH5N/c1-2-3-6-7(4-13)11(15)16-12-9(6)10(14)8(5-17)18-12;1-2/h5H,2-3,14H2,1H3,(H2,15,16);2H2,1H3 |
| InChIKey | FZLBWNUVAXBHOU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 131.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|