C13H9ClN4OS — CID 143513623
2,5-diamino-4-(4-chlorophenyl)thieno[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 143513623) has the molecular formula C13H9ClN4OS and a molecular weight of 304.76 g/mol. Its IUPAC name is 2,5-diamino-4-(4-chlorophenyl)thieno[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 2,5-diamino-4-(4-chlorophenyl)thieno[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 143513623 |
| Molecular Formula | C13H9ClN4OS |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2,5-diamino-4-(4-chlorophenyl)thieno[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | Nc1nc(-c2ccc(Cl)cc2)c2c(N)c(C=O)sc2n1 |
| InChI | InChI=1S/C13H9ClN4OS/c14-7-3-1-6(2-4-7)11-9-10(15)8(5-19)20-12(9)18-13(16)17-11/h1-5H,15H2,(H2,16,17,18) |
| InChIKey | IEDXWMFNOAEMHR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|