C14H10ClN3OS2 — CID 87957723
5-amino-4-(4-chlorophenyl)-2-methylthieno[2,3-d]pyrimidine-6-carbothioic S-acid (PubChem CID 87957723) has the molecular formula C14H10ClN3OS2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 5-amino-4-(4-chlorophenyl)-2-methylthieno[2,3-d]pyrimidine-6-carbothioic S-acid.
| Compound Name | 5-amino-4-(4-chlorophenyl)-2-methylthieno[2,3-d]pyrimidine-6-carbothioic S-acid |
|---|---|
| PubChem CID | 87957723 |
| Molecular Formula | C14H10ClN3OS2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 5-amino-4-(4-chlorophenyl)-2-methylthieno[2,3-d]pyrimidine-6-carbothioic S-acid |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)c2c(N)c(C(=O)S)sc2n1 |
| InChI | InChI=1S/C14H10ClN3OS2/c1-6-17-11(7-2-4-8(15)5-3-7)9-10(16)12(14(19)20)21-13(9)18-6/h2-5H,16H2,1H3,(H,19,20) |
| InChIKey | PHZZXJAOMVWABR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|