C19H18N4OS — CID 143295061
5-amino-4-methyl-2-naphthalen-1-ylthieno[2,3-d]pyrimidine-6-carbaldehyde;methanamine (PubChem CID 143295061) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 5-amino-4-methyl-2-naphthalen-1-ylthieno[2,3-d]pyrimidine-6-carbaldehyde;methanamine.
| Compound Name | 5-amino-4-methyl-2-naphthalen-1-ylthieno[2,3-d]pyrimidine-6-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 143295061 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 5-amino-4-methyl-2-naphthalen-1-ylthieno[2,3-d]pyrimidine-6-carbaldehyde;methanamine |
| SMILES | CN.Cc1nc(-c2cccc3ccccc23)nc2sc(C=O)c(N)c12 |
| InChI | InChI=1S/C18H13N3OS.CH5N/c1-10-15-16(19)14(9-22)23-18(15)21-17(20-10)13-8-4-6-11-5-2-3-7-12(11)13;1-2/h2-9H,19H2,1H3;2H2,1H3 |
| InChIKey | MZVPVFOOVDIYSA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|