C16H18ClN5OS — CID 143513606
5-amino-4-(4-chlorophenyl)-2-(methylamino)thieno[2,3-d]pyrimidine-6-carbaldehyde;N-methylmethanamine (PubChem CID 143513606) has the molecular formula C16H18ClN5OS and a molecular weight of 363.87 g/mol. Its IUPAC name is 5-amino-4-(4-chlorophenyl)-2-(methylamino)thieno[2,3-d]pyrimidine-6-carbaldehyde;N-methylmethanamine.
| Compound Name | 5-amino-4-(4-chlorophenyl)-2-(methylamino)thieno[2,3-d]pyrimidine-6-carbaldehyde;N-methylmethanamine |
|---|---|
| PubChem CID | 143513606 |
| Molecular Formula | C16H18ClN5OS |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 5-amino-4-(4-chlorophenyl)-2-(methylamino)thieno[2,3-d]pyrimidine-6-carbaldehyde;N-methylmethanamine |
| SMILES | CNC.CNc1nc(-c2ccc(Cl)cc2)c2c(N)c(C=O)sc2n1 |
| InChI | InChI=1S/C14H11ClN4OS.C2H7N/c1-17-14-18-12(7-2-4-8(15)5-3-7)10-11(16)9(6-20)21-13(10)19-14;1-3-2/h2-6H,16H2,1H3,(H,17,18,19);3H,1-2H3 |
| InChIKey | NSJVVPHEVVAIFV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|