C15H11Cl2N5O3S — CID 90948503
carbamoyl 5-amino-4-(2,4-dichlorophenyl)-2-(methylamino)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 90948503) has the molecular formula C15H11Cl2N5O3S and a molecular weight of 412.26 g/mol. Its IUPAC name is carbamoyl 5-amino-4-(2,4-dichlorophenyl)-2-(methylamino)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | carbamoyl 5-amino-4-(2,4-dichlorophenyl)-2-(methylamino)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 90948503 |
| Molecular Formula | C15H11Cl2N5O3S |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | carbamoyl 5-amino-4-(2,4-dichlorophenyl)-2-(methylamino)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CNc1nc(-c2ccc(Cl)cc2Cl)c2c(N)c(C(=O)OC(N)=O)sc2n1 |
| InChI | InChI=1S/C15H11Cl2N5O3S/c1-20-15-21-10(6-3-2-5(16)4-7(6)17)8-9(18)11(26-12(8)22-15)13(23)25-14(19)24/h2-4H,18H2,1H3,(H2,19,24)(H,20,21,22) |
| InChIKey | CNVIXXNIENOXTE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|