C17H17Cl2N5O2S — CID 59647118
5-amino-4-(3,4-dichlorophenyl)-2-(3-methoxypropylamino)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59647118) has the molecular formula C17H17Cl2N5O2S and a molecular weight of 426.33 g/mol. Its IUPAC name is 5-amino-4-(3,4-dichlorophenyl)-2-(3-methoxypropylamino)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-amino-4-(3,4-dichlorophenyl)-2-(3-methoxypropylamino)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59647118 |
| Molecular Formula | C17H17Cl2N5O2S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 5-amino-4-(3,4-dichlorophenyl)-2-(3-methoxypropylamino)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COCCCNc1nc(-c2ccc(Cl)c(Cl)c2)c2c(N)c(C(N)=O)sc2n1 |
| InChI | InChI=1S/C17H17Cl2N5O2S/c1-26-6-2-5-22-17-23-13(8-3-4-9(18)10(19)7-8)11-12(20)14(15(21)25)27-16(11)24-17/h3-4,7H,2,5-6,20H2,1H3,(H2,21,25)(H,22,23,24) |
| InChIKey | OHGZOIIOTMBAKZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|