C14H7Cl2N5OS — CID 59647023
5-amino-4-(3,4-dichlorophenyl)-2-isocyanothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59647023) has the molecular formula C14H7Cl2N5OS and a molecular weight of 364.22 g/mol. Its IUPAC name is 5-amino-4-(3,4-dichlorophenyl)-2-isocyanothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 5-amino-4-(3,4-dichlorophenyl)-2-isocyanothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59647023 |
| Molecular Formula | C14H7Cl2N5OS |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 5-amino-4-(3,4-dichlorophenyl)-2-isocyanothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | [C-]#[N+]c1nc(-c2ccc(Cl)c(Cl)c2)c2c(N)c(C(N)=O)sc2n1 |
| InChI | InChI=1S/C14H7Cl2N5OS/c1-19-14-20-10(5-2-3-6(15)7(16)4-5)8-9(17)11(12(18)22)23-13(8)21-14/h2-4H,17H2,(H2,18,22) |
| InChIKey | MWBGDCJJCVQGCV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|