C16H18ClN5OS — CID 143513636
[5-amino-4-(4-chlorophenyl)-2-(ethylamino)thieno[2,3-d]pyrimidin-6-yl]-(methylamino)methanol (PubChem CID 143513636) has the molecular formula C16H18ClN5OS and a molecular weight of 363.87 g/mol. Its IUPAC name is [5-amino-4-(4-chlorophenyl)-2-(ethylamino)thieno[2,3-d]pyrimidin-6-yl]-(methylamino)methanol.
| Compound Name | [5-amino-4-(4-chlorophenyl)-2-(ethylamino)thieno[2,3-d]pyrimidin-6-yl]-(methylamino)methanol |
|---|---|
| PubChem CID | 143513636 |
| Molecular Formula | C16H18ClN5OS |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [5-amino-4-(4-chlorophenyl)-2-(ethylamino)thieno[2,3-d]pyrimidin-6-yl]-(methylamino)methanol |
| SMILES | CCNc1nc(-c2ccc(Cl)cc2)c2c(N)c(C(O)NC)sc2n1 |
| InChI | InChI=1S/C16H18ClN5OS/c1-3-20-16-21-12(8-4-6-9(17)7-5-8)10-11(18)13(14(23)19-2)24-15(10)22-16/h4-7,14,19,23H,3,18H2,1-2H3,(H,20,21,22) |
| InChIKey | IGKDYAZJUDRWNA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|