C13H14N4OS — CID 146020849
11,13-diamino-4,4-dimethyl-5-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-12-carbonitrile (PubChem CID 146020849) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 11,13-diamino-4,4-dimethyl-5-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-12-carbonitrile.
| Compound Name | 11,13-diamino-4,4-dimethyl-5-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-12-carbonitrile |
|---|---|
| PubChem CID | 146020849 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 11,13-diamino-4,4-dimethyl-5-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-12-carbonitrile |
| SMILES | CC1(C)Cc2c(sc3nc(N)c(C#N)c(N)c23)CO1 |
| InChI | InChI=1S/C13H14N4OS/c1-13(2)3-6-8(5-18-13)19-12-9(6)10(15)7(4-14)11(16)17-12/h3,5H2,1-2H3,(H4,15,16,17) |
| InChIKey | TUWRLERTZBAMAT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |