C20H24N4OS2 — CID 3713806
5-(3,5-dimethylpyrazol-1-yl)-12,12-dimethyl-3-(2-methylprop-2-enylsulfanyl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene (PubChem CID 3713806) has the molecular formula C20H24N4OS2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 5-(3,5-dimethylpyrazol-1-yl)-12,12-dimethyl-3-(2-methylprop-2-enylsulfanyl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene.
| Compound Name | 5-(3,5-dimethylpyrazol-1-yl)-12,12-dimethyl-3-(2-methylprop-2-enylsulfanyl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
|---|---|
| PubChem CID | 3713806 |
| Molecular Formula | C20H24N4OS2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 5-(3,5-dimethylpyrazol-1-yl)-12,12-dimethyl-3-(2-methylprop-2-enylsulfanyl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene |
| SMILES | C=C(C)CSc1nc(-n2nc(C)cc2C)nc2sc3c(c12)CC(C)(C)OC3 |
| InChI | InChI=1S/C20H24N4OS2/c1-11(2)10-26-17-16-14-8-20(5,6)25-9-15(14)27-18(16)22-19(21-17)24-13(4)7-12(3)23-24/h7H,1,8-10H2,2-6H3 |
| InChIKey | XPJINEYSLFHTDY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|