C10H10N4O2S3 — CID 143295066
2-(5-amino-6-formyl-4-methylsulfanylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 143295066) has the molecular formula C10H10N4O2S3 and a molecular weight of 314.42 g/mol. Its IUPAC name is 2-(5-amino-6-formyl-4-methylsulfanylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | 2-(5-amino-6-formyl-4-methylsulfanylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 143295066 |
| Molecular Formula | C10H10N4O2S3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 2-(5-amino-6-formyl-4-methylsulfanylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | CSc1nc(SCC(N)=O)nc2sc(C=O)c(N)c12 |
| InChI | InChI=1S/C10H10N4O2S3/c1-17-8-6-7(12)4(2-15)19-9(6)14-10(13-8)18-3-5(11)16/h2H,3,12H2,1H3,(H2,11,16) |
| InChIKey | RLGJTYSFWBRCFW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|