C16H24N2O2S — CID 143185664
3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbaldehyde;2-methoxypropane (PubChem CID 143185664) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbaldehyde;2-methoxypropane.
| Compound Name | 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbaldehyde;2-methoxypropane |
|---|---|
| PubChem CID | 143185664 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbaldehyde;2-methoxypropane |
| SMILES | CCc1c(C)nc2sc(C=O)c(N)c2c1C.COC(C)C |
| InChI | InChI=1S/C12H14N2OS.C4H10O/c1-4-8-6(2)10-11(13)9(5-15)16-12(10)14-7(8)3;1-4(2)5-3/h5H,4,13H2,1-3H3;4H,1-3H3 |
| InChIKey | TZTZQCYLDCAYAV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|