About 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile
3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile (PubChem CID 3689734) has the molecular formula C12H13N3S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile |
| PubChem CID | 3689734 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile |
| SMILES | CCc1c(C)nc2sc(C#N)c(N)c2c1C |
| InChI | InChI=1S/C12H13N3S/c1-4-8-6(2)10-11(14)9(5-13)16-12(10)15-7(8)3/h4,14H2,1-3H3 |
| InChIKey | UUJGLZRXEIKCSC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile?
The IUPAC name of 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile (CID 3689734) is 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile.
What is the SMILES notation for 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile?
The canonical SMILES for 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile is CCc1c(C)nc2sc(C#N)c(N)c2c1C.
What is the InChIKey of 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile?
The InChIKey is UUJGLZRXEIKCSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3S/c1-4-8-6(2)10-11(14)9(5-13)16-12(10)15-7(8)3/h4,14H2,1-3H3.
What are the key properties of 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile?
3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile has a molecular weight of 231.32 g/mol, XLogP of 2.93, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carbonitrile is sourced from PubChem (CID 3689734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).