C12H13N5O2S — CID 103508015
methyl 3-amino-4-cyano-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxylate (PubChem CID 103508015) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103508015 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | methyl 3-amino-4-cyano-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NCCn2cccn2)c(C#N)c1N |
| InChI | InChI=1S/C12H13N5O2S/c1-19-12(18)10-9(14)8(7-13)11(20-10)15-4-6-17-5-2-3-16-17/h2-3,5,15H,4,6,14H2,1H3 |
| InChIKey | QCJSXJMSTTVLKB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |