C12H16N4O2S2 — CID 103507973
methyl 3-amino-4-methylsulfanyl-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxylate (PubChem CID 103507973) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is methyl 3-amino-4-methylsulfanyl-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-methylsulfanyl-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103507973 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | methyl 3-amino-4-methylsulfanyl-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NCCn2cccn2)c(SC)c1N |
| InChI | InChI=1S/C12H16N4O2S2/c1-18-12(17)10-8(13)9(19-2)11(20-10)14-5-7-16-6-3-4-15-16/h3-4,6,14H,5,7,13H2,1-2H3 |
| InChIKey | BGNNHAUNVYTXEM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |