C10H13N5OS — CID 103507981
3-amino-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxamide (PubChem CID 103507981) has the molecular formula C10H13N5OS and a molecular weight of 251.32 g/mol. Its IUPAC name is 3-amino-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103507981 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-amino-5-(2-pyrazol-1-ylethylamino)thiophene-2-carboxamide |
| SMILES | NC(=O)c1sc(NCCn2cccn2)cc1N |
| InChI | InChI=1S/C10H13N5OS/c11-7-6-8(17-9(7)10(12)16)13-3-5-15-4-1-2-14-15/h1-2,4,6,13H,3,5,11H2,(H2,12,16) |
| InChIKey | BCSISJDLDIZPHD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |