C17H17N5S — CID 110169224
2-(3-imidazol-1-ylpropylamino)-4-methyl-5-pyridin-4-ylthiophene-3-carbonitrile (PubChem CID 110169224) has the molecular formula C17H17N5S and a molecular weight of 323.43 g/mol. Its IUPAC name is 2-(3-imidazol-1-ylpropylamino)-4-methyl-5-pyridin-4-ylthiophene-3-carbonitrile.
| Compound Name | 2-(3-imidazol-1-ylpropylamino)-4-methyl-5-pyridin-4-ylthiophene-3-carbonitrile |
|---|---|
| PubChem CID | 110169224 |
| Molecular Formula | C17H17N5S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-(3-imidazol-1-ylpropylamino)-4-methyl-5-pyridin-4-ylthiophene-3-carbonitrile |
| SMILES | Cc1c(-c2ccncc2)sc(NCCCn2ccnc2)c1C#N |
| InChI | InChI=1S/C17H17N5S/c1-13-15(11-18)17(21-5-2-9-22-10-8-20-12-22)23-16(13)14-3-6-19-7-4-14/h3-4,6-8,10,12,21H,2,5,9H2,1H3 |
| InChIKey | JLVXXFSDNONKCA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|