C10H15N5O2S2 — CID 103382745
5-N-(3-imidazol-1-ylpropyl)-4-methylsulfonyl-1,2-thiazole-3,5-diamine (PubChem CID 103382745) has the molecular formula C10H15N5O2S2 and a molecular weight of 301.40 g/mol. Its IUPAC name is 5-N-(3-imidazol-1-ylpropyl)-4-methylsulfonyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(3-imidazol-1-ylpropyl)-4-methylsulfonyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103382745 |
| Molecular Formula | C10H15N5O2S2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-N-(3-imidazol-1-ylpropyl)-4-methylsulfonyl-1,2-thiazole-3,5-diamine |
| SMILES | CS(=O)(=O)c1c(N)nsc1NCCCn1ccnc1 |
| InChI | InChI=1S/C10H15N5O2S2/c1-19(16,17)8-9(11)14-18-10(8)13-3-2-5-15-6-4-12-7-15/h4,6-7,13H,2-3,5H2,1H3,(H2,11,14) |
| InChIKey | SKTZVEPBZQPKBF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|