C13H16N6S2 — CID 103382750
5-N-(3-imidazol-1-ylpropyl)-4-(2-methyl-1,3-thiazol-4-yl)-1,2-thiazole-3,5-diamine (PubChem CID 103382750) has the molecular formula C13H16N6S2 and a molecular weight of 320.45 g/mol. Its IUPAC name is 5-N-(3-imidazol-1-ylpropyl)-4-(2-methyl-1,3-thiazol-4-yl)-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(3-imidazol-1-ylpropyl)-4-(2-methyl-1,3-thiazol-4-yl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103382750 |
| Molecular Formula | C13H16N6S2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5-N-(3-imidazol-1-ylpropyl)-4-(2-methyl-1,3-thiazol-4-yl)-1,2-thiazole-3,5-diamine |
| SMILES | Cc1nc(-c2c(N)nsc2NCCCn2ccnc2)cs1 |
| InChI | InChI=1S/C13H16N6S2/c1-9-17-10(7-20-9)11-12(14)18-21-13(11)16-3-2-5-19-6-4-15-8-19/h4,6-8,16H,2-3,5H2,1H3,(H2,14,18) |
| InChIKey | MCVBWVGTCNKSBQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|