C14H22N4OS2 — CID 103379335
5-N-[2-(3-methylbutoxy)ethyl]-4-(2-methyl-1,3-thiazol-4-yl)-1,2-thiazole-3,5-diamine (PubChem CID 103379335) has the molecular formula C14H22N4OS2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 5-N-[2-(3-methylbutoxy)ethyl]-4-(2-methyl-1,3-thiazol-4-yl)-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-[2-(3-methylbutoxy)ethyl]-4-(2-methyl-1,3-thiazol-4-yl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103379335 |
| Molecular Formula | C14H22N4OS2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 5-N-[2-(3-methylbutoxy)ethyl]-4-(2-methyl-1,3-thiazol-4-yl)-1,2-thiazole-3,5-diamine |
| SMILES | Cc1nc(-c2c(N)nsc2NCCOCCC(C)C)cs1 |
| InChI | InChI=1S/C14H22N4OS2/c1-9(2)4-6-19-7-5-16-14-12(13(15)18-21-14)11-8-20-10(3)17-11/h8-9,16H,4-7H2,1-3H3,(H2,15,18) |
| InChIKey | ATIUSHHPNDLWQD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|