C11H17N5O2S2 — CID 103359563
4-propylsulfonyl-5-N-(2-pyrazol-1-ylethyl)-1,2-thiazole-3,5-diamine (PubChem CID 103359563) has the molecular formula C11H17N5O2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-propylsulfonyl-5-N-(2-pyrazol-1-ylethyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-propylsulfonyl-5-N-(2-pyrazol-1-ylethyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103359563 |
| Molecular Formula | C11H17N5O2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 4-propylsulfonyl-5-N-(2-pyrazol-1-ylethyl)-1,2-thiazole-3,5-diamine |
| SMILES | CCCS(=O)(=O)c1c(N)nsc1NCCn1cccn1 |
| InChI | InChI=1S/C11H17N5O2S2/c1-2-8-20(17,18)9-10(12)15-19-11(9)13-5-7-16-6-3-4-14-16/h3-4,6,13H,2,5,7-8H2,1H3,(H2,12,15) |
| InChIKey | WSGAVGMDMXNDTE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |