C10H18N4O3S2 — CID 103364028
N-[2-[(3-amino-4-propylsulfonyl-1,2-thiazol-5-yl)amino]ethyl]acetamide (PubChem CID 103364028) has the molecular formula C10H18N4O3S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[2-[(3-amino-4-propylsulfonyl-1,2-thiazol-5-yl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(3-amino-4-propylsulfonyl-1,2-thiazol-5-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 103364028 |
| Molecular Formula | C10H18N4O3S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-[2-[(3-amino-4-propylsulfonyl-1,2-thiazol-5-yl)amino]ethyl]acetamide |
| SMILES | CCCS(=O)(=O)c1c(N)nsc1NCCNC(C)=O |
| InChI | InChI=1S/C10H18N4O3S2/c1-3-6-19(16,17)8-9(11)14-18-10(8)13-5-4-12-7(2)15/h13H,3-6H2,1-2H3,(H2,11,14)(H,12,15) |
| InChIKey | ZNRVAPXRYCHRQZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|