C12H23N3O4S2 — CID 103365343
4-ethylsulfonyl-5-N-[4-(2-methoxyethoxy)butyl]-1,2-thiazole-3,5-diamine (PubChem CID 103365343) has the molecular formula C12H23N3O4S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 4-ethylsulfonyl-5-N-[4-(2-methoxyethoxy)butyl]-1,2-thiazole-3,5-diamine.
| Compound Name | 4-ethylsulfonyl-5-N-[4-(2-methoxyethoxy)butyl]-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103365343 |
| Molecular Formula | C12H23N3O4S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-ethylsulfonyl-5-N-[4-(2-methoxyethoxy)butyl]-1,2-thiazole-3,5-diamine |
| SMILES | CCS(=O)(=O)c1c(N)nsc1NCCCCOCCOC |
| InChI | InChI=1S/C12H23N3O4S2/c1-3-21(16,17)10-11(13)15-20-12(10)14-6-4-5-7-19-9-8-18-2/h14H,3-9H2,1-2H3,(H2,13,15) |
| InChIKey | FUXMRYXYIHKXSF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|