C11H19N3O3S2 — CID 106412790
5-N-(2-but-3-enoxyethyl)-4-ethylsulfonyl-1,2-thiazole-3,5-diamine (PubChem CID 106412790) has the molecular formula C11H19N3O3S2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 5-N-(2-but-3-enoxyethyl)-4-ethylsulfonyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(2-but-3-enoxyethyl)-4-ethylsulfonyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 106412790 |
| Molecular Formula | C11H19N3O3S2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 5-N-(2-but-3-enoxyethyl)-4-ethylsulfonyl-1,2-thiazole-3,5-diamine |
| SMILES | C=CCCOCCNc1snc(N)c1S(=O)(=O)CC |
| InChI | InChI=1S/C11H19N3O3S2/c1-3-5-7-17-8-6-13-11-9(10(12)14-18-11)19(15,16)4-2/h3,13H,1,4-8H2,2H3,(H2,12,14) |
| InChIKey | KTKDXXRXGQZEBP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|