C10H14N4OS — CID 106412796
3-amino-5-(2-but-3-enoxyethylamino)-1,2-thiazole-4-carbonitrile (PubChem CID 106412796) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is 3-amino-5-(2-but-3-enoxyethylamino)-1,2-thiazole-4-carbonitrile.
| Compound Name | 3-amino-5-(2-but-3-enoxyethylamino)-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 106412796 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 3-amino-5-(2-but-3-enoxyethylamino)-1,2-thiazole-4-carbonitrile |
| SMILES | C=CCCOCCNc1snc(N)c1C#N |
| InChI | InChI=1S/C10H14N4OS/c1-2-3-5-15-6-4-13-10-8(7-11)9(12)14-16-10/h2,13H,1,3-6H2,(H2,12,14) |
| InChIKey | TVDGETFYKUXTSJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|