C9H14N4OS2 — CID 106311997
3-amino-5-[2-(3-hydroxypropylsulfanyl)ethylamino]-1,2-thiazole-4-carbonitrile (PubChem CID 106311997) has the molecular formula C9H14N4OS2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-amino-5-[2-(3-hydroxypropylsulfanyl)ethylamino]-1,2-thiazole-4-carbonitrile.
| Compound Name | 3-amino-5-[2-(3-hydroxypropylsulfanyl)ethylamino]-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 106311997 |
| Molecular Formula | C9H14N4OS2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-amino-5-[2-(3-hydroxypropylsulfanyl)ethylamino]-1,2-thiazole-4-carbonitrile |
| SMILES | N#Cc1c(N)nsc1NCCSCCCO |
| InChI | InChI=1S/C9H14N4OS2/c10-6-7-8(11)13-16-9(7)12-2-5-15-4-1-3-14/h12,14H,1-5H2,(H2,11,13) |
| InChIKey | RDAPYLLVRAAVEL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|