C10H14N4S — CID 103384602
3-amino-5-(3-cyclopropylpropylamino)-1,2-thiazole-4-carbonitrile (PubChem CID 103384602) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is 3-amino-5-(3-cyclopropylpropylamino)-1,2-thiazole-4-carbonitrile.
| Compound Name | 3-amino-5-(3-cyclopropylpropylamino)-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 103384602 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3-amino-5-(3-cyclopropylpropylamino)-1,2-thiazole-4-carbonitrile |
| SMILES | N#Cc1c(N)nsc1NCCCC1CC1 |
| InChI | InChI=1S/C10H14N4S/c11-6-8-9(12)14-15-10(8)13-5-1-2-7-3-4-7/h7,13H,1-5H2,(H2,12,14) |
| InChIKey | YQQWSUINFICTLI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|