C7H8ClN3OS — CID 47214811
3-chloro-5-(2-methoxyethylamino)-1,2-thiazole-4-carbonitrile (PubChem CID 47214811) has the molecular formula C7H8ClN3OS and a molecular weight of 217.68 g/mol. Its IUPAC name is 3-chloro-5-(2-methoxyethylamino)-1,2-thiazole-4-carbonitrile.
| Compound Name | 3-chloro-5-(2-methoxyethylamino)-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 47214811 |
| Molecular Formula | C7H8ClN3OS |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 3-chloro-5-(2-methoxyethylamino)-1,2-thiazole-4-carbonitrile |
| SMILES | COCCNc1snc(Cl)c1C#N |
| InChI | InChI=1S/C7H8ClN3OS/c1-12-3-2-10-7-5(4-9)6(8)11-13-7/h10H,2-3H2,1H3 |
| InChIKey | KQJWMITZMLAZJE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|