C13H9Cl3N4OS — CID 78899210
3,4-dichloro-N-[2-[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]ethyl]benzamide (PubChem CID 78899210) has the molecular formula C13H9Cl3N4OS and a molecular weight of 375.67 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 78899210 |
| Molecular Formula | C13H9Cl3N4OS |
| Molecular Weight | 375.67 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 3,4-dichloro-N-[2-[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]ethyl]benzamide |
| SMILES | N#Cc1c(Cl)nsc1NCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl3N4OS/c14-9-2-1-7(5-10(9)15)12(21)18-3-4-19-13-8(6-17)11(16)20-22-13/h1-2,5,19H,3-4H2,(H,18,21) |
| InChIKey | JXYOVMBEKZUWMQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|