C13H10ClFN4OS — CID 133271442
N-[2-[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]ethyl]-2-fluorobenzamide (PubChem CID 133271442) has the molecular formula C13H10ClFN4OS and a molecular weight of 324.77 g/mol. Its IUPAC name is N-[2-[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 133271442 |
| Molecular Formula | C13H10ClFN4OS |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-[2-[(3-chloro-4-cyano-1,2-thiazol-5-yl)amino]ethyl]-2-fluorobenzamide |
| SMILES | N#Cc1c(Cl)nsc1NCCNC(=O)c1ccccc1F |
| InChI | InChI=1S/C13H10ClFN4OS/c14-11-9(7-16)13(21-19-11)18-6-5-17-12(20)8-3-1-2-4-10(8)15/h1-4,18H,5-6H2,(H,17,20) |
| InChIKey | OXFNFCCZFWZTFH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|