C10H17N3O2S2 — CID 103349511
5-N-butyl-4-cyclopropylsulfonyl-1,2-thiazole-3,5-diamine (PubChem CID 103349511) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 5-N-butyl-4-cyclopropylsulfonyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-butyl-4-cyclopropylsulfonyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103349511 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-N-butyl-4-cyclopropylsulfonyl-1,2-thiazole-3,5-diamine |
| SMILES | CCCCNc1snc(N)c1S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C10H17N3O2S2/c1-2-3-6-12-10-8(9(11)13-16-10)17(14,15)7-4-5-7/h7,12H,2-6H2,1H3,(H2,11,13) |
| InChIKey | GHINTYKCKZAYPX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|