About 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine
4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine (PubChem CID 103349793) has the molecular formula C10H17N3O2S3
and a molecular weight of 307.47 g/mol. Its IUPAC name is 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine |
| PubChem CID | 103349793 |
| Molecular Formula | C10H17N3O2S3 |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine |
| SMILES | CSC(C)CNc1snc(N)c1S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C10H17N3O2S3/c1-6(16-2)5-12-10-8(9(11)13-17-10)18(14,15)7-3-4-7/h6-7,12H,3-5H2,1-2H3,(H2,11,13) |
| InChIKey | JAAZBINUBDYGHS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine?
The IUPAC name of 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine (CID 103349793) is 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine.
What is the SMILES notation for 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine?
The canonical SMILES for 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine is CSC(C)CNc1snc(N)c1S(=O)(=O)C1CC1.
What is the InChIKey of 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine?
The InChIKey is JAAZBINUBDYGHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2S3/c1-6(16-2)5-12-10-8(9(11)13-17-10)18(14,15)7-3-4-7/h6-7,12H,3-5H2,1-2H3,(H2,11,13).
What are the key properties of 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine?
4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine has a molecular weight of 307.47 g/mol, XLogP of 1.82, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropylsulfonyl-5-N-(2-methylsulfanylpropyl)-1,2-thiazole-3,5-diamine is sourced from PubChem (CID 103349793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).