C11H17N5S — CID 65277183
3-ethyl-N-(4-imidazol-1-ylbutyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65277183) has the molecular formula C11H17N5S and a molecular weight of 251.36 g/mol. Its IUPAC name is 3-ethyl-N-(4-imidazol-1-ylbutyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-ethyl-N-(4-imidazol-1-ylbutyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65277183 |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-ethyl-N-(4-imidazol-1-ylbutyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(NCCCCn2ccnc2)n1 |
| InChI | InChI=1S/C11H17N5S/c1-2-10-14-11(17-15-10)13-5-3-4-7-16-8-6-12-9-16/h6,8-9H,2-5,7H2,1H3,(H,13,14,15) |
| InChIKey | VEKKIKHXMGYEAJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|