C12H16ClN5S — CID 80547015
6-chloro-N-(4-imidazol-1-ylbutyl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80547015) has the molecular formula C12H16ClN5S and a molecular weight of 297.82 g/mol. Its IUPAC name is 6-chloro-N-(4-imidazol-1-ylbutyl)-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(4-imidazol-1-ylbutyl)-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80547015 |
| Molecular Formula | C12H16ClN5S |
| Molecular Weight | 297.82 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 6-chloro-N-(4-imidazol-1-ylbutyl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(NCCCCn2ccnc2)n1 |
| InChI | InChI=1S/C12H16ClN5S/c1-19-12-16-10(13)8-11(17-12)15-4-2-3-6-18-7-5-14-9-18/h5,7-9H,2-4,6H2,1H3,(H,15,16,17) |
| InChIKey | PCEIJVGIWMQCSU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|