C12H15N7S — CID 141086103
N-(3-imidazol-1-ylpropyl)-2-methylsulfanylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 141086103) has the molecular formula C12H15N7S and a molecular weight of 289.37 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-methylsulfanylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-methylsulfanylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 141086103 |
| Molecular Formula | C12H15N7S |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-methylsulfanylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CSc1nc(NCCCn2ccnc2)n2nccc2n1 |
| InChI | InChI=1S/C12H15N7S/c1-20-12-16-10-3-5-15-19(10)11(17-12)14-4-2-7-18-8-6-13-9-18/h3,5-6,8-9H,2,4,7H2,1H3,(H,14,16,17) |
| InChIKey | CCUKOMCFHGSFMJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 72.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|