C15H22ClN5 — CID 80946117
2-tert-butyl-6-chloro-N-(4-imidazol-1-ylbutyl)pyrimidin-4-amine (PubChem CID 80946117) has the molecular formula C15H22ClN5 and a molecular weight of 307.83 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-N-(4-imidazol-1-ylbutyl)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-chloro-N-(4-imidazol-1-ylbutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80946117 |
| Molecular Formula | C15H22ClN5 |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-tert-butyl-6-chloro-N-(4-imidazol-1-ylbutyl)pyrimidin-4-amine |
| SMILES | CC(C)(C)c1nc(Cl)cc(NCCCCn2ccnc2)n1 |
| InChI | InChI=1S/C15H22ClN5/c1-15(2,3)14-19-12(16)10-13(20-14)18-6-4-5-8-21-9-7-17-11-21/h7,9-11H,4-6,8H2,1-3H3,(H,18,19,20) |
| InChIKey | AVUXZGODRKASDZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|