About 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine
5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine (PubChem CID 103360361) has the molecular formula C10H20N4S2
and a molecular weight of 260.43 g/mol. Its IUPAC name is 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine.
Molecular Properties
| Compound Name | 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine |
| PubChem CID | 103360361 |
| Molecular Formula | C10H20N4S2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine |
| SMILES | CSc1c(N)nsc1NCCCCN(C)C |
| InChI | InChI=1S/C10H20N4S2/c1-14(2)7-5-4-6-12-10-8(15-3)9(11)13-16-10/h12H,4-7H2,1-3H3,(H2,11,13) |
| InChIKey | MODDGFYFZZPYGL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine?
The IUPAC name of 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine (CID 103360361) is 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine.
What is the SMILES notation for 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine?
The canonical SMILES for 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine is CSc1c(N)nsc1NCCCCN(C)C.
What is the InChIKey of 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine?
The InChIKey is MODDGFYFZZPYGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4S2/c1-14(2)7-5-4-6-12-10-8(15-3)9(11)13-16-10/h12H,4-7H2,1-3H3,(H2,11,13).
What are the key properties of 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine?
5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine has a molecular weight of 260.43 g/mol, XLogP of 2.20, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-[4-(dimethylamino)butyl]-4-methylsulfanyl-1,2-thiazole-3,5-diamine is sourced from PubChem (CID 103360361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).